C21H20ClF3N2O5S — CID 150660764
2-[3-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]propylamino]ethanesulfonamide (PubChem CID 150660764) has the molecular formula C21H20ClF3N2O5S and a molecular weight of 504.91 g/mol. Its IUPAC name is 2-[3-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]propylamino]ethanesulfonamide.
| Compound Name | 2-[3-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]propylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 150660764 |
| Molecular Formula | C21H20ClF3N2O5S |
| Molecular Weight | 504.91 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 2-[3-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]propylamino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNCCCOc1cc(C(F)(F)F)ccc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C21H20ClF3N2O5S/c22-16-4-1-3-14-17(28)12-19(32-20(14)16)15-6-5-13(21(23,24)25)11-18(15)31-9-2-7-27-8-10-33(26,29)30/h1,3-6,11-12,27H,2,7-10H2,(H2,26,29,30) |
| InChIKey | JDVLUCBRAUTQNC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|