C27H25ClN2O6S — CID 154928270
1-[3-[2-(8-chloro-4-oxochromen-2-yl)-5-methylphenoxy]propyl]-3-(4-methylphenyl)sulfonylurea (PubChem CID 154928270) has the molecular formula C27H25ClN2O6S and a molecular weight of 541.03 g/mol. Its IUPAC name is 1-[3-[2-(8-chloro-4-oxochromen-2-yl)-5-methylphenoxy]propyl]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-[3-[2-(8-chloro-4-oxochromen-2-yl)-5-methylphenoxy]propyl]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 154928270 |
| Molecular Formula | C27H25ClN2O6S |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 1-[3-[2-(8-chloro-4-oxochromen-2-yl)-5-methylphenoxy]propyl]-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NCCCOc2cc(C)ccc2-c2cc(=O)c3cccc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C27H25ClN2O6S/c1-17-7-10-19(11-8-17)37(33,34)30-27(32)29-13-4-14-35-24-15-18(2)9-12-21(24)25-16-23(31)20-5-3-6-22(28)26(20)36-25/h3,5-12,15-16H,4,13-14H2,1-2H3,(H2,29,30,32) |
| InChIKey | NXXOWMJBAFYUCR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|