C21H17BrClNO7 — CID 154647338
2-[3-[2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]propylamino]-2-oxoacetic acid (PubChem CID 154647338) has the molecular formula C21H17BrClNO7 and a molecular weight of 510.72 g/mol. Its IUPAC name is 2-[3-[2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]propylamino]-2-oxoacetic acid.
| Compound Name | 2-[3-[2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]propylamino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 154647338 |
| Molecular Formula | C21H17BrClNO7 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 508.99 |
| IUPAC Name | 2-[3-[2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]propylamino]-2-oxoacetic acid |
| SMILES | COc1cc(Br)c(OCCCNC(=O)C(=O)O)cc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C21H17BrClNO7/c1-29-16-9-13(22)18(30-7-3-6-24-20(26)21(27)28)8-12(16)17-10-15(25)11-4-2-5-14(23)19(11)31-17/h2,4-5,8-10H,3,6-7H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | ZWHYBFMWKHWUQK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|