C19H17BrClNO4 — CID 154647340
2-[3-(3-aminopropoxy)-4-bromo-2-methoxyphenyl]-8-chlorochromen-4-one (PubChem CID 154647340) has the molecular formula C19H17BrClNO4 and a molecular weight of 438.71 g/mol. Its IUPAC name is 2-[3-(3-aminopropoxy)-4-bromo-2-methoxyphenyl]-8-chlorochromen-4-one.
| Compound Name | 2-[3-(3-aminopropoxy)-4-bromo-2-methoxyphenyl]-8-chlorochromen-4-one |
|---|---|
| PubChem CID | 154647340 |
| Molecular Formula | C19H17BrClNO4 |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 2-[3-(3-aminopropoxy)-4-bromo-2-methoxyphenyl]-8-chlorochromen-4-one |
| SMILES | COc1c(-c2cc(=O)c3cccc(Cl)c3o2)ccc(Br)c1OCCCN |
| InChI | InChI=1S/C19H17BrClNO4/c1-24-18-12(6-7-13(20)19(18)25-9-3-8-22)16-10-15(23)11-4-2-5-14(21)17(11)26-16/h2,4-7,10H,3,8-9,22H2,1H3 |
| InChIKey | YUGQYOCSOBTDNI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|