C24H16BrClO6 — CID 146460214
4-[2-[5-bromo-2-(8-chloro-4-oxochromen-2-yl)phenoxy]ethoxy]benzoic acid (PubChem CID 146460214) has the molecular formula C24H16BrClO6 and a molecular weight of 515.74 g/mol. Its IUPAC name is 4-[2-[5-bromo-2-(8-chloro-4-oxochromen-2-yl)phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[5-bromo-2-(8-chloro-4-oxochromen-2-yl)phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 146460214 |
| Molecular Formula | C24H16BrClO6 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 513.98 |
| IUPAC Name | 4-[2-[5-bromo-2-(8-chloro-4-oxochromen-2-yl)phenoxy]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCOc2cc(Br)ccc2-c2cc(=O)c3cccc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C24H16BrClO6/c25-15-6-9-18(22-13-20(27)17-2-1-3-19(26)23(17)32-22)21(12-15)31-11-10-30-16-7-4-14(5-8-16)24(28)29/h1-9,12-13H,10-11H2,(H,28,29) |
| InChIKey | JHIMXQLWKLLFQT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|