C20H14ClF3O6 — CID 146460158
4-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethoxy)phenoxy]butanoic acid (PubChem CID 146460158) has the molecular formula C20H14ClF3O6 and a molecular weight of 442.77 g/mol. Its IUPAC name is 4-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethoxy)phenoxy]butanoic acid.
| Compound Name | 4-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethoxy)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 146460158 |
| Molecular Formula | C20H14ClF3O6 |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 4-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethoxy)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cc(OC(F)(F)F)ccc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C20H14ClF3O6/c21-14-4-1-3-12-15(25)10-17(29-19(12)14)13-7-6-11(30-20(22,23)24)9-16(13)28-8-2-5-18(26)27/h1,3-4,6-7,9-10H,2,5,8H2,(H,26,27) |
| InChIKey | ZEDFGUAFIHIELB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|