C19H14ClFO5 — CID 146460035
3-[2-(8-chloro-4-oxochromen-2-yl)-3-fluoro-5-methylphenoxy]propanoic acid (PubChem CID 146460035) has the molecular formula C19H14ClFO5 and a molecular weight of 376.77 g/mol. Its IUPAC name is 3-[2-(8-chloro-4-oxochromen-2-yl)-3-fluoro-5-methylphenoxy]propanoic acid.
| Compound Name | 3-[2-(8-chloro-4-oxochromen-2-yl)-3-fluoro-5-methylphenoxy]propanoic acid |
|---|---|
| PubChem CID | 146460035 |
| Molecular Formula | C19H14ClFO5 |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 3-[2-(8-chloro-4-oxochromen-2-yl)-3-fluoro-5-methylphenoxy]propanoic acid |
| SMILES | Cc1cc(F)c(-c2cc(=O)c3cccc(Cl)c3o2)c(OCCC(=O)O)c1 |
| InChI | InChI=1S/C19H14ClFO5/c1-10-7-13(21)18(15(8-10)25-6-5-17(23)24)16-9-14(22)11-3-2-4-12(20)19(11)26-16/h2-4,7-9H,5-6H2,1H3,(H,23,24) |
| InChIKey | WBUSOQVOMBNPJC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |