C26H29ClO7 — CID 174198648
2-[3-[5-(8-chloro-4-oxochromen-2-yl)-4-methoxy-2-methylphenoxy]propoxy]-3,3-dimethylbutanoic acid (PubChem CID 174198648) has the molecular formula C26H29ClO7 and a molecular weight of 488.96 g/mol. Its IUPAC name is 2-[3-[5-(8-chloro-4-oxochromen-2-yl)-4-methoxy-2-methylphenoxy]propoxy]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[3-[5-(8-chloro-4-oxochromen-2-yl)-4-methoxy-2-methylphenoxy]propoxy]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 174198648 |
| Molecular Formula | C26H29ClO7 |
| Molecular Weight | 488.96 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-[3-[5-(8-chloro-4-oxochromen-2-yl)-4-methoxy-2-methylphenoxy]propoxy]-3,3-dimethylbutanoic acid |
| SMILES | COc1cc(C)c(OCCCOC(C(=O)O)C(C)(C)C)cc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C26H29ClO7/c1-15-12-21(31-5)17(22-14-19(28)16-8-6-9-18(27)23(16)34-22)13-20(15)32-10-7-11-33-24(25(29)30)26(2,3)4/h6,8-9,12-14,24H,7,10-11H2,1-5H3,(H,29,30) |
| InChIKey | MMXSVMZNKZUZCN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.96 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|