C27H28Cl2O7 — CID 174198239
1-tert-butyl-3-[2-[2-chloro-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]ethoxy]cyclobutane-1-carboxylic acid (PubChem CID 174198239) has the molecular formula C27H28Cl2O7 and a molecular weight of 535.42 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[2-chloro-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]ethoxy]cyclobutane-1-carboxylic acid.
| Compound Name | 1-tert-butyl-3-[2-[2-chloro-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]ethoxy]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 174198239 |
| Molecular Formula | C27H28Cl2O7 |
| Molecular Weight | 535.42 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 1-tert-butyl-3-[2-[2-chloro-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]ethoxy]cyclobutane-1-carboxylic acid |
| SMILES | COc1cc(Cl)c(OCCOC2CC(C(=O)O)(C(C)(C)C)C2)cc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C27H28Cl2O7/c1-26(2,3)27(25(31)32)13-15(14-27)34-8-9-35-23-10-17(21(33-4)11-19(23)29)22-12-20(30)16-6-5-7-18(28)24(16)36-22/h5-7,10-12,15H,8-9,13-14H2,1-4H3,(H,31,32) |
| InChIKey | XLLUEFRSAFYVLK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.42 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|