C22H19ClO6 — CID 155004651
3-[5-(8-chloro-4-oxochromen-2-yl)-2,4-dimethoxyphenoxy]cyclobutane-1-carbaldehyde (PubChem CID 155004651) has the molecular formula C22H19ClO6 and a molecular weight of 414.84 g/mol. Its IUPAC name is 3-[5-(8-chloro-4-oxochromen-2-yl)-2,4-dimethoxyphenoxy]cyclobutane-1-carbaldehyde.
| Compound Name | 3-[5-(8-chloro-4-oxochromen-2-yl)-2,4-dimethoxyphenoxy]cyclobutane-1-carbaldehyde |
|---|---|
| PubChem CID | 155004651 |
| Molecular Formula | C22H19ClO6 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3-[5-(8-chloro-4-oxochromen-2-yl)-2,4-dimethoxyphenoxy]cyclobutane-1-carbaldehyde |
| SMILES | COc1cc(OC)c(-c2cc(=O)c3cccc(Cl)c3o2)cc1OC1CC(C=O)C1 |
| InChI | InChI=1S/C22H19ClO6/c1-26-18-10-20(27-2)21(28-13-6-12(7-13)11-24)8-15(18)19-9-17(25)14-4-3-5-16(23)22(14)29-19/h3-5,8-13H,6-7H2,1-2H3 |
| InChIKey | ZJEJJOFIPKEDIP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|