C21H16Cl2O6 — CID 175149245
[2-chloro-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenyl] cyclobutanecarboperoxoate (PubChem CID 175149245) has the molecular formula C21H16Cl2O6 and a molecular weight of 435.26 g/mol. Its IUPAC name is [2-chloro-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenyl] cyclobutanecarboperoxoate.
| Compound Name | [2-chloro-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenyl] cyclobutanecarboperoxoate |
|---|---|
| PubChem CID | 175149245 |
| Molecular Formula | C21H16Cl2O6 |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | [2-chloro-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenyl] cyclobutanecarboperoxoate |
| SMILES | COc1cc(Cl)c(OOC(=O)C2CCC2)cc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C21H16Cl2O6/c1-26-17-9-15(23)19(28-29-21(25)11-4-2-5-11)8-13(17)18-10-16(24)12-6-3-7-14(22)20(12)27-18/h3,6-11H,2,4-5H2,1H3 |
| InChIKey | NRTXYFDLQNQNGD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|