C22H21ClO7 — CID 154647312
2-[3-[5-(8-chloro-4-oxochromen-2-yl)-4-methoxy-2-methylphenoxy]propoxy]acetic acid (PubChem CID 154647312) has the molecular formula C22H21ClO7 and a molecular weight of 432.86 g/mol. Its IUPAC name is 2-[3-[5-(8-chloro-4-oxochromen-2-yl)-4-methoxy-2-methylphenoxy]propoxy]acetic acid.
| Compound Name | 2-[3-[5-(8-chloro-4-oxochromen-2-yl)-4-methoxy-2-methylphenoxy]propoxy]acetic acid |
|---|---|
| PubChem CID | 154647312 |
| Molecular Formula | C22H21ClO7 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-[3-[5-(8-chloro-4-oxochromen-2-yl)-4-methoxy-2-methylphenoxy]propoxy]acetic acid |
| SMILES | COc1cc(C)c(OCCCOCC(=O)O)cc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C22H21ClO7/c1-13-9-19(27-2)15(10-18(13)29-8-4-7-28-12-21(25)26)20-11-17(24)14-5-3-6-16(23)22(14)30-20/h3,5-6,9-11H,4,7-8,12H2,1-2H3,(H,25,26) |
| InChIKey | GMFMSPGLCDPLPM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|