About [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate
[2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate (PubChem CID 156786029) has the molecular formula C20H16BrClO6
and a molecular weight of 467.70 g/mol. Its IUPAC name is [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate.
Molecular Properties
| Compound Name | [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate |
| PubChem CID | 156786029 |
| Molecular Formula | C20H16BrClO6 |
| Molecular Weight | 467.70 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate |
| SMILES | CCOc1cc(Br)c(OOC(=O)CC)cc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C20H16BrClO6/c1-3-19(24)28-27-18-8-12(16(25-4-2)9-13(18)21)17-10-15(23)11-6-5-7-14(22)20(11)26-17/h5-10H,3-4H2,1-2H3 |
| InChIKey | QIPWRVZGACYUFK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate?
The IUPAC name of [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate (CID 156786029) is [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate.
What is the SMILES notation for [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate?
The canonical SMILES for [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate is CCOc1cc(Br)c(OOC(=O)CC)cc1-c1cc(=O)c2cccc(Cl)c2o1.
What is the InChIKey of [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate?
The InChIKey is QIPWRVZGACYUFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16BrClO6/c1-3-19(24)28-27-18-8-12(16(25-4-2)9-13(18)21)17-10-15(23)11-6-5-7-14(22)20(11)26-17/h5-10H,3-4H2,1-2H3.
What are the key properties of [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate?
[2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate has a molecular weight of 467.70 g/mol, XLogP of 5.52, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-ethoxyphenyl] propaneperoxoate is sourced from PubChem (CID 156786029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).