C23H20ClF3O5 — CID 164987796
ethyl 5-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]pentanoate (PubChem CID 164987796) has the molecular formula C23H20ClF3O5 and a molecular weight of 468.86 g/mol. Its IUPAC name is ethyl 5-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]pentanoate.
| Compound Name | ethyl 5-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]pentanoate |
|---|---|
| PubChem CID | 164987796 |
| Molecular Formula | C23H20ClF3O5 |
| Molecular Weight | 468.86 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | ethyl 5-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]pentanoate |
| SMILES | CCOC(=O)CCCCOc1cc(C(F)(F)F)ccc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C23H20ClF3O5/c1-2-30-21(29)8-3-4-11-31-19-12-14(23(25,26)27)9-10-16(19)20-13-18(28)15-6-5-7-17(24)22(15)32-20/h5-7,9-10,12-13H,2-4,8,11H2,1H3 |
| InChIKey | GKFOAIQVJNDUTQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.86 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|