C22H19ClO6 — CID 154647337
3-[3-(8-chloro-4-oxochromen-2-yl)-2-methoxy-6-methylphenoxy]cyclobutane-1-carboxylic acid (PubChem CID 154647337) has the molecular formula C22H19ClO6 and a molecular weight of 414.84 g/mol. Its IUPAC name is 3-[3-(8-chloro-4-oxochromen-2-yl)-2-methoxy-6-methylphenoxy]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[3-(8-chloro-4-oxochromen-2-yl)-2-methoxy-6-methylphenoxy]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 154647337 |
| Molecular Formula | C22H19ClO6 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3-[3-(8-chloro-4-oxochromen-2-yl)-2-methoxy-6-methylphenoxy]cyclobutane-1-carboxylic acid |
| SMILES | COc1c(-c2cc(=O)c3cccc(Cl)c3o2)ccc(C)c1OC1CC(C(=O)O)C1 |
| InChI | InChI=1S/C22H19ClO6/c1-11-6-7-15(18-10-17(24)14-4-3-5-16(23)20(14)29-18)21(27-2)19(11)28-13-8-12(9-13)22(25)26/h3-7,10,12-13H,8-9H2,1-2H3,(H,25,26) |
| InChIKey | SYHOVZWKMGNYRJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |