C20H18O7 — CID 10595321
2-[4-oxo-2-(2,3,4-trimethoxyphenyl)chromen-8-yl]acetic acid (PubChem CID 10595321) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-[4-oxo-2-(2,3,4-trimethoxyphenyl)chromen-8-yl]acetic acid.
| Compound Name | 2-[4-oxo-2-(2,3,4-trimethoxyphenyl)chromen-8-yl]acetic acid |
|---|---|
| PubChem CID | 10595321 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[4-oxo-2-(2,3,4-trimethoxyphenyl)chromen-8-yl]acetic acid |
| SMILES | COc1ccc(-c2cc(=O)c3cccc(CC(=O)O)c3o2)c(OC)c1OC |
| InChI | InChI=1S/C20H18O7/c1-24-15-8-7-13(19(25-2)20(15)26-3)16-10-14(21)12-6-4-5-11(9-17(22)23)18(12)27-16/h4-8,10H,9H2,1-3H3,(H,22,23) |
| InChIKey | RPQRJFMUDIZMAO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |