C21H19NaO8 — CID 102329162
sodium 2-[4-oxo-2-(2,3,4,5-tetramethoxyphenyl)chromen-8-yl]acetate (PubChem CID 102329162) has the molecular formula C21H19NaO8 and a molecular weight of 422.37 g/mol. Its IUPAC name is sodium 2-[4-oxo-2-(2,3,4,5-tetramethoxyphenyl)chromen-8-yl]acetate.
| Compound Name | sodium 2-[4-oxo-2-(2,3,4,5-tetramethoxyphenyl)chromen-8-yl]acetate |
|---|---|
| PubChem CID | 102329162 |
| Molecular Formula | C21H19NaO8 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | sodium 2-[4-oxo-2-(2,3,4,5-tetramethoxyphenyl)chromen-8-yl]acetate |
| SMILES | COc1cc(-c2cc(=O)c3cccc(CC(=O)[O-])c3o2)c(OC)c(OC)c1OC.[Na+] |
| InChI | InChI=1S/C21H20O8.Na/c1-25-16-9-13(19(26-2)21(28-4)20(16)27-3)15-10-14(22)12-7-5-6-11(8-17(23)24)18(12)29-15;/h5-7,9-10H,8H2,1-4H3,(H,23,24);/q;+1/p-1 |
| InChIKey | PHVWYTPYUBKMSV-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 107.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |