C23H20BrClO7 — CID 154647348
3-[2-[6-bromo-3-(8-chloro-4-oxochromen-2-yl)-2-methoxyphenoxy]ethoxy]cyclobutane-1-carboxylic acid (PubChem CID 154647348) has the molecular formula C23H20BrClO7 and a molecular weight of 523.76 g/mol. Its IUPAC name is 3-[2-[6-bromo-3-(8-chloro-4-oxochromen-2-yl)-2-methoxyphenoxy]ethoxy]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[2-[6-bromo-3-(8-chloro-4-oxochromen-2-yl)-2-methoxyphenoxy]ethoxy]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 154647348 |
| Molecular Formula | C23H20BrClO7 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | 3-[2-[6-bromo-3-(8-chloro-4-oxochromen-2-yl)-2-methoxyphenoxy]ethoxy]cyclobutane-1-carboxylic acid |
| SMILES | COc1c(-c2cc(=O)c3cccc(Cl)c3o2)ccc(Br)c1OCCOC1CC(C(=O)O)C1 |
| InChI | InChI=1S/C23H20BrClO7/c1-29-21-15(19-11-18(26)14-3-2-4-17(25)20(14)32-19)5-6-16(24)22(21)31-8-7-30-13-9-12(10-13)23(27)28/h2-6,11-13H,7-10H2,1H3,(H,27,28) |
| InChIKey | KHSACONODMJENX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|