C21H17ClO6 — CID 146493702
cis-(1S,2R)-2-[2-[4-(8-chloro-4-oxochromen-2-yl)phenoxy]ethoxy]cyclopropane-1-carboxylic acid (PubChem CID 146493702) has the molecular formula C21H17ClO6 and a molecular weight of 400.81 g/mol. Its IUPAC name is cis-(1S,2R)-2-[2-[4-(8-chloro-4-oxochromen-2-yl)phenoxy]ethoxy]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[2-[4-(8-chloro-4-oxochromen-2-yl)phenoxy]ethoxy]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 146493702 |
| Molecular Formula | C21H17ClO6 |
| Molecular Weight | 400.81 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | cis-(1S,2R)-2-[2-[4-(8-chloro-4-oxochromen-2-yl)phenoxy]ethoxy]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@H]1OCCOc1ccc(-c2cc(=O)c3cccc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C21H17ClO6/c22-16-3-1-2-14-17(23)11-18(28-20(14)16)12-4-6-13(7-5-12)26-8-9-27-19-10-15(19)21(24)25/h1-7,11,15,19H,8-10H2,(H,24,25)/t15-,19+/m0/s1 |
| InChIKey | SDRFAWDRVMHDLT-HNAYVOBHSA-N |
| XLogP | 3.98 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|