C22H19ClO5S — CID 146443522
3-[2-[4-(8-chloro-4-oxothiochromen-2-yl)phenoxy]ethoxy]cyclobutane-1-carboxylic acid (PubChem CID 146443522) has the molecular formula C22H19ClO5S and a molecular weight of 430.91 g/mol. Its IUPAC name is 3-[2-[4-(8-chloro-4-oxothiochromen-2-yl)phenoxy]ethoxy]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[2-[4-(8-chloro-4-oxothiochromen-2-yl)phenoxy]ethoxy]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 146443522 |
| Molecular Formula | C22H19ClO5S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 3-[2-[4-(8-chloro-4-oxothiochromen-2-yl)phenoxy]ethoxy]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(OCCOc2ccc(-c3cc(=O)c4cccc(Cl)c4s3)cc2)C1 |
| InChI | InChI=1S/C22H19ClO5S/c23-18-3-1-2-17-19(24)12-20(29-21(17)18)13-4-6-15(7-5-13)27-8-9-28-16-10-14(11-16)22(25)26/h1-7,12,14,16H,8-11H2,(H,25,26) |
| InChIKey | WKZLQSHFWVBZDX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|