About 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid
2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid (PubChem CID 54768175) has the molecular formula C18H13Cl2NO3S
and a molecular weight of 394.28 g/mol. Its IUPAC name is 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid |
| PubChem CID | 54768175 |
| Molecular Formula | C18H13Cl2NO3S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid |
| SMILES | Nc1sc(-c2ccc(OCc3c(Cl)cccc3Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C18H13Cl2NO3S/c19-14-2-1-3-15(20)13(14)9-24-11-6-4-10(5-7-11)16-8-12(18(22)23)17(21)25-16/h1-8H,9,21H2,(H,22,23) |
| InChIKey | ABJBWIIKGXBSOM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid?
The IUPAC name of 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid (CID 54768175) is 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid.
What is the SMILES notation for 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid?
The canonical SMILES for 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid is Nc1sc(-c2ccc(OCc3c(Cl)cccc3Cl)cc2)cc1C(=O)O.
What is the InChIKey of 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid?
The InChIKey is ABJBWIIKGXBSOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2NO3S/c19-14-2-1-3-15(20)13(14)9-24-11-6-4-10(5-7-11)16-8-12(18(22)23)17(21)25-16/h1-8H,9,21H2,(H,22,23).
What are the key properties of 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid?
2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid has a molecular weight of 394.28 g/mol, XLogP of 5.58, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]thiophene-3-carboxylic acid is sourced from PubChem (CID 54768175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).