C24H25Cl2NO3S — CID 54768387
5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-(hexylamino)thiophene-3-carboxylic acid (PubChem CID 54768387) has the molecular formula C24H25Cl2NO3S and a molecular weight of 478.44 g/mol. Its IUPAC name is 5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-(hexylamino)thiophene-3-carboxylic acid.
| Compound Name | 5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-(hexylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 54768387 |
| Molecular Formula | C24H25Cl2NO3S |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 5-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-(hexylamino)thiophene-3-carboxylic acid |
| SMILES | CCCCCCNc1sc(-c2ccc(OCc3c(Cl)cccc3Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C24H25Cl2NO3S/c1-2-3-4-5-13-27-23-18(24(28)29)14-22(31-23)16-9-11-17(12-10-16)30-15-19-20(25)7-6-8-21(19)26/h6-12,14,27H,2-5,13,15H2,1H3,(H,28,29) |
| InChIKey | ROUQDQUVGDGREO-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|