C22H20BrClO6 — CID 146460554
3-[2-[5-bromo-2-[(E)-3-(3-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]phenoxy]ethoxy]cyclobutane-1-carboxylic acid (PubChem CID 146460554) has the molecular formula C22H20BrClO6 and a molecular weight of 495.75 g/mol. Its IUPAC name is 3-[2-[5-bromo-2-[(E)-3-(3-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]phenoxy]ethoxy]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[2-[5-bromo-2-[(E)-3-(3-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]phenoxy]ethoxy]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 146460554 |
| Molecular Formula | C22H20BrClO6 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 3-[2-[5-bromo-2-[(E)-3-(3-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]phenoxy]ethoxy]cyclobutane-1-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc(Br)cc1OCCOC1CC(C(=O)O)C1)c1cccc(Cl)c1O |
| InChI | InChI=1S/C22H20BrClO6/c23-15-6-4-13(5-7-19(25)17-2-1-3-18(24)21(17)26)20(12-15)30-9-8-29-16-10-14(11-16)22(27)28/h1-7,12,14,16,26H,8-11H2,(H,27,28)/b7-5+ |
| InChIKey | SPLZTZJOXJZEHH-FNORWQNLSA-N |
| XLogP | 4.96 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|