C19H13BrClF3O6 — CID 154647281
3-[2-bromo-5-[(E)-3-(3-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-4-(trifluoromethoxy)phenoxy]propanoic acid (PubChem CID 154647281) has the molecular formula C19H13BrClF3O6 and a molecular weight of 509.66 g/mol. Its IUPAC name is 3-[2-bromo-5-[(E)-3-(3-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-4-(trifluoromethoxy)phenoxy]propanoic acid.
| Compound Name | 3-[2-bromo-5-[(E)-3-(3-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-4-(trifluoromethoxy)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 154647281 |
| Molecular Formula | C19H13BrClF3O6 |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 507.95 |
| IUPAC Name | 3-[2-bromo-5-[(E)-3-(3-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-4-(trifluoromethoxy)phenoxy]propanoic acid |
| SMILES | O=C(O)CCOc1cc(/C=C/C(=O)c2cccc(Cl)c2O)c(OC(F)(F)F)cc1Br |
| InChI | InChI=1S/C19H13BrClF3O6/c20-12-9-15(30-19(22,23)24)10(8-16(12)29-7-6-17(26)27)4-5-14(25)11-2-1-3-13(21)18(11)28/h1-5,8-9,28H,6-7H2,(H,26,27)/b5-4+ |
| InChIKey | BAPJKOYJSMNNSZ-SNAWJCMRSA-N |
| XLogP | 5.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|