About 3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid
3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid (PubChem CID 75941447) has the molecular formula C18H13Cl3O4
and a molecular weight of 399.60 g/mol. Its IUPAC name is 3-[3-[3-oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid.
Molecular Properties
| Compound Name | 3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid |
| PubChem CID | 75941447 |
| Molecular Formula | C18H13Cl3O4 |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 3-[3-[3-oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid |
| SMILES | C1=CC(=CC(=C1)OCCC(=O)O)C=CC(=O)C2=C(C(=C(C=C2)Cl)Cl)Cl |
| InChI | InChI=1S/C18H13Cl3O4/c19-14-6-5-13(17(20)18(14)21)15(22)7-4-11-2-1-3-12(10-11)25-9-8-16(23)24/h1-7,10H,8-9H2,(H,23,24) |
| InChIKey | UPDBBLYAOFPELQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | 497 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid?
The IUPAC name of 3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid (CID 75941447) is 3-[3-[3-oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid.
What is the SMILES notation for 3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid?
The canonical SMILES for 3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid is C1=CC(=CC(=C1)OCCC(=O)O)C=CC(=O)C2=C(C(=C(C=C2)Cl)Cl)Cl.
What is the InChIKey of 3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid?
The InChIKey is UPDBBLYAOFPELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl3O4/c19-14-6-5-13(17(20)18(14)21)15(22)7-4-11-2-1-3-12(10-11)25-9-8-16(23)24/h1-7,10H,8-9H2,(H,23,24).
What are the key properties of 3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid?
3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid has a molecular weight of 399.60 g/mol, XLogP of 5.00, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[3-Oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid is sourced from PubChem (CID 75941447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).