C18H13Cl3O4 — CID 75941447
3-[3-[3-oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid (PubChem CID 75941447) has the molecular formula C18H13Cl3O4 and a molecular weight of 399.66 g/mol. Its IUPAC name is 3-[3-[3-oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid.
| Compound Name | 3-[3-[3-oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 75941447 |
| Molecular Formula | C18H13Cl3O4 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 3-[3-[3-oxo-3-(2,3,4-trichlorophenyl)prop-1-enyl]phenoxy]propanoic acid |
| SMILES | O=C(O)CCOc1cccc(C=CC(=O)c2ccc(Cl)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C18H13Cl3O4/c19-14-6-5-13(17(20)18(14)21)15(22)7-4-11-2-1-3-12(10-11)25-9-8-16(23)24/h1-7,10H,8-9H2,(H,23,24) |
| InChIKey | UPDBBLYAOFPELQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|