C19H18Cl2O2 — CID 19569184
(E)-1-(3,4-dichlorophenyl)-3-[3-(2-methylpropoxy)phenyl]prop-2-en-1-one (PubChem CID 19569184) has the molecular formula C19H18Cl2O2 and a molecular weight of 349.26 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-3-[3-(2-methylpropoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-3-[3-(2-methylpropoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19569184 |
| Molecular Formula | C19H18Cl2O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-3-[3-(2-methylpropoxy)phenyl]prop-2-en-1-one |
| SMILES | CC(C)COc1cccc(/C=C/C(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H18Cl2O2/c1-13(2)12-23-16-5-3-4-14(10-16)6-9-19(22)15-7-8-17(20)18(21)11-15/h3-11,13H,12H2,1-2H3/b9-6+ |
| InChIKey | SKCUOWPPGDWBHQ-RMKNXTFCSA-N |
| XLogP | 5.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|