C18H14Cl2O4 — CID 76877685
methyl 2-[4-[3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]acetate (PubChem CID 76877685) has the molecular formula C18H14Cl2O4 and a molecular weight of 365.21 g/mol. Its IUPAC name is methyl 2-[4-[3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 76877685 |
| Molecular Formula | C18H14Cl2O4 |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | methyl 2-[4-[3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(=O)C=Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H14Cl2O4/c1-23-18(22)11-24-14-6-4-13(5-7-14)17(21)9-3-12-2-8-15(19)16(20)10-12/h2-10H,11H2,1H3 |
| InChIKey | PYGPNOJUOYYZDR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|