C20H20O4 — CID 76877741
methyl 2-[4-[3-(2,4-dimethylphenyl)prop-2-enoyl]phenoxy]acetate (PubChem CID 76877741) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl 2-[4-[3-(2,4-dimethylphenyl)prop-2-enoyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[3-(2,4-dimethylphenyl)prop-2-enoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 76877741 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | methyl 2-[4-[3-(2,4-dimethylphenyl)prop-2-enoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(=O)C=Cc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C20H20O4/c1-14-4-5-16(15(2)12-14)8-11-19(21)17-6-9-18(10-7-17)24-13-20(22)23-3/h4-12H,13H2,1-3H3 |
| InChIKey | LMKFESFWLPNVMO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|