C21H23NO5 — CID 8827183
2-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 8827183) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 8827183 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OCC(=O)N(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H23NO5/c1-22(2)21(24)14-27-17-9-5-15(6-10-17)19(23)12-8-16-7-11-18(25-3)13-20(16)26-4/h5-13H,14H2,1-4H3/b12-8+ |
| InChIKey | LPXLTDVAAODNRK-XYOKQWHBSA-N |
| XLogP | 3.07 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|