C15H11Cl2NO — CID 12051019
(E)-1-(4-aminophenyl)-3-(3,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 12051019) has the molecular formula C15H11Cl2NO and a molecular weight of 292.17 g/mol. Its IUPAC name is (E)-1-(4-aminophenyl)-3-(3,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-aminophenyl)-3-(3,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 12051019 |
| Molecular Formula | C15H11Cl2NO |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (E)-1-(4-aminophenyl)-3-(3,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | Nc1ccc(C(=O)/C=C/c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H11Cl2NO/c16-13-7-1-10(9-14(13)17)2-8-15(19)11-3-5-12(18)6-4-11/h1-9H,18H2/b8-2+ |
| InChIKey | PJKNZHCLMKAQTN-KRXBUXKQSA-N |
| XLogP | 4.47 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|