C17H11Cl2FO3S — CID 18291707
2-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-fluorophenyl]sulfanylacetic acid (PubChem CID 18291707) has the molecular formula C17H11Cl2FO3S and a molecular weight of 385.24 g/mol. Its IUPAC name is 2-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-fluorophenyl]sulfanylacetic acid.
| Compound Name | 2-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-fluorophenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 18291707 |
| Molecular Formula | C17H11Cl2FO3S |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 2-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-fluorophenyl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1ccc(C(=O)/C=C/c2ccc(Cl)c(Cl)c2)cc1F |
| InChI | InChI=1S/C17H11Cl2FO3S/c18-12-4-1-10(7-13(12)19)2-5-15(21)11-3-6-16(14(20)8-11)24-9-17(22)23/h1-8H,9H2,(H,22,23)/b5-2+ |
| InChIKey | FDVVQNQZNUMWJN-GORDUTHDSA-N |
| XLogP | 5.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|