C21H16Cl2O8 — CID 134581538
2-O-[[2-[4-[(E)-3-(3,4-dichlorophenyl)-3-oxoprop-1-enyl]phenoxy]acetyl]oxymethyl] 1-O-methyl oxalate (PubChem CID 134581538) has the molecular formula C21H16Cl2O8 and a molecular weight of 467.26 g/mol. Its IUPAC name is 2-O-[[2-[4-[(E)-3-(3,4-dichlorophenyl)-3-oxoprop-1-enyl]phenoxy]acetyl]oxymethyl] 1-O-methyl oxalate.
| Compound Name | 2-O-[[2-[4-[(E)-3-(3,4-dichlorophenyl)-3-oxoprop-1-enyl]phenoxy]acetyl]oxymethyl] 1-O-methyl oxalate |
|---|---|
| PubChem CID | 134581538 |
| Molecular Formula | C21H16Cl2O8 |
| Molecular Weight | 467.26 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 2-O-[[2-[4-[(E)-3-(3,4-dichlorophenyl)-3-oxoprop-1-enyl]phenoxy]acetyl]oxymethyl] 1-O-methyl oxalate |
| SMILES | COC(=O)C(=O)OCOC(=O)COc1ccc(/C=C/C(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H16Cl2O8/c1-28-20(26)21(27)31-12-30-19(25)11-29-15-6-2-13(3-7-15)4-9-18(24)14-5-8-16(22)17(23)10-14/h2-10H,11-12H2,1H3/b9-4+ |
| InChIKey | NGZHMDOLGLRCNP-RUDMXATFSA-N |
| XLogP | 3.49 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|