C21H18ClF3O7 — CID 154939611
3-[2-[(E)-3-[3-chloro-2-hydroxy-6-(methoxymethoxy)phenyl]-3-oxoprop-1-enyl]-5-(trifluoromethyl)phenoxy]propanoic acid (PubChem CID 154939611) has the molecular formula C21H18ClF3O7 and a molecular weight of 474.82 g/mol. Its IUPAC name is 3-[2-[(E)-3-[3-chloro-2-hydroxy-6-(methoxymethoxy)phenyl]-3-oxoprop-1-enyl]-5-(trifluoromethyl)phenoxy]propanoic acid.
| Compound Name | 3-[2-[(E)-3-[3-chloro-2-hydroxy-6-(methoxymethoxy)phenyl]-3-oxoprop-1-enyl]-5-(trifluoromethyl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 154939611 |
| Molecular Formula | C21H18ClF3O7 |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 3-[2-[(E)-3-[3-chloro-2-hydroxy-6-(methoxymethoxy)phenyl]-3-oxoprop-1-enyl]-5-(trifluoromethyl)phenoxy]propanoic acid |
| SMILES | COCOc1ccc(Cl)c(O)c1C(=O)/C=C/c1ccc(C(F)(F)F)cc1OCCC(=O)O |
| InChI | InChI=1S/C21H18ClF3O7/c1-30-11-32-16-7-5-14(22)20(29)19(16)15(26)6-3-12-2-4-13(21(23,24)25)10-17(12)31-9-8-18(27)28/h2-7,10,29H,8-9,11H2,1H3,(H,27,28)/b6-3+ |
| InChIKey | ISTCGPXBBFBELG-ZZXKWVIFSA-N |
| XLogP | 4.80 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|