C26H31F6NO5 — CID 160601755
2-butoxy-N-methoxy-N-methyl-4-(trifluoromethyl)benzamide;2-butoxy-4-(trifluoromethyl)benzaldehyde (PubChem CID 160601755) has the molecular formula C26H31F6NO5 and a molecular weight of 551.52 g/mol. Its IUPAC name is 2-butoxy-N-methoxy-N-methyl-4-(trifluoromethyl)benzamide;2-butoxy-4-(trifluoromethyl)benzaldehyde.
| Compound Name | 2-butoxy-N-methoxy-N-methyl-4-(trifluoromethyl)benzamide;2-butoxy-4-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 160601755 |
| Molecular Formula | C26H31F6NO5 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 2-butoxy-N-methoxy-N-methyl-4-(trifluoromethyl)benzamide;2-butoxy-4-(trifluoromethyl)benzaldehyde |
| SMILES | CCCCOc1cc(C(F)(F)F)ccc1C(=O)N(C)OC.CCCCOc1cc(C(F)(F)F)ccc1C=O |
| InChI | InChI=1S/C14H18F3NO3.C12H13F3O2/c1-4-5-8-21-12-9-10(14(15,16)17)6-7-11(12)13(19)18(2)20-3;1-2-3-6-17-11-7-10(12(13,14)15)5-4-9(11)8-16/h6-7,9H,4-5,8H2,1-3H3;4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | REJCHDMOZMHXRM-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|