C24H26F6O6 — CID 158273826
butyl 2-butoxy-4-(trifluoromethyl)benzoate;2-hydroxy-4-(trifluoromethyl)benzoic acid (PubChem CID 158273826) has the molecular formula C24H26F6O6 and a molecular weight of 524.45 g/mol. Its IUPAC name is butyl 2-butoxy-4-(trifluoromethyl)benzoate;2-hydroxy-4-(trifluoromethyl)benzoic acid.
| Compound Name | butyl 2-butoxy-4-(trifluoromethyl)benzoate;2-hydroxy-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 158273826 |
| Molecular Formula | C24H26F6O6 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | butyl 2-butoxy-4-(trifluoromethyl)benzoate;2-hydroxy-4-(trifluoromethyl)benzoic acid |
| SMILES | CCCCOC(=O)c1ccc(C(F)(F)F)cc1OCCCC.O=C(O)c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C16H21F3O3.C8H5F3O3/c1-3-5-9-21-14-11-12(16(17,18)19)7-8-13(14)15(20)22-10-6-4-2;9-8(10,11)4-1-2-5(7(13)14)6(12)3-4/h7-8,11H,3-6,9-10H2,1-2H3;1-3,12H,(H,13,14) |
| InChIKey | GJJCQFOGUCJTHZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|