C19H15F3O4 — CID 52614208
3-[4-[(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl]phenoxy]propanoic acid (PubChem CID 52614208) has the molecular formula C19H15F3O4 and a molecular weight of 364.32 g/mol. Its IUPAC name is 3-[4-[(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl]phenoxy]propanoic acid.
| Compound Name | 3-[4-[(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 52614208 |
| Molecular Formula | C19H15F3O4 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 3-[4-[(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl]phenoxy]propanoic acid |
| SMILES | O=C(O)CCOc1ccc(/C=C/C(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H15F3O4/c20-19(21,22)15-3-1-2-14(12-15)17(23)9-6-13-4-7-16(8-5-13)26-11-10-18(24)25/h1-9,12H,10-11H2,(H,24,25)/b9-6+ |
| InChIKey | RKRAGPWYAREIMH-RMKNXTFCSA-N |
| XLogP | 4.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|