C18H14ClNO6 — CID 52614187
3-[4-[(E)-3-(4-chloro-3-nitrophenyl)-3-oxoprop-1-enyl]phenoxy]propanoic acid (PubChem CID 52614187) has the molecular formula C18H14ClNO6 and a molecular weight of 375.76 g/mol. Its IUPAC name is 3-[4-[(E)-3-(4-chloro-3-nitrophenyl)-3-oxoprop-1-enyl]phenoxy]propanoic acid.
| Compound Name | 3-[4-[(E)-3-(4-chloro-3-nitrophenyl)-3-oxoprop-1-enyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 52614187 |
| Molecular Formula | C18H14ClNO6 |
| Molecular Weight | 375.76 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 3-[4-[(E)-3-(4-chloro-3-nitrophenyl)-3-oxoprop-1-enyl]phenoxy]propanoic acid |
| SMILES | O=C(O)CCOc1ccc(/C=C/C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H14ClNO6/c19-15-7-4-13(11-16(15)20(24)25)17(21)8-3-12-1-5-14(6-2-12)26-10-9-18(22)23/h1-8,11H,9-10H2,(H,22,23)/b8-3+ |
| InChIKey | MJNQKJVZBNHNNF-FPYGCLRLSA-N |
| XLogP | 4.00 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|