C20H17ClO4 — CID 146443693
8-chloro-2-[4-[(3-hydroxycyclobutyl)methoxy]phenyl]chromen-4-one (PubChem CID 146443693) has the molecular formula C20H17ClO4 and a molecular weight of 356.81 g/mol. Its IUPAC name is 8-chloro-2-[4-[(3-hydroxycyclobutyl)methoxy]phenyl]chromen-4-one.
| Compound Name | 8-chloro-2-[4-[(3-hydroxycyclobutyl)methoxy]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 146443693 |
| Molecular Formula | C20H17ClO4 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 8-chloro-2-[4-[(3-hydroxycyclobutyl)methoxy]phenyl]chromen-4-one |
| SMILES | O=c1cc(-c2ccc(OCC3CC(O)C3)cc2)oc2c(Cl)cccc12 |
| InChI | InChI=1S/C20H17ClO4/c21-17-3-1-2-16-18(23)10-19(25-20(16)17)13-4-6-15(7-5-13)24-11-12-8-14(22)9-12/h1-7,10,12,14,22H,8-9,11H2 |
| InChIKey | USGWJZBDLRNCLY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |