C27H24ClNO12 — CID 146460258
3-[2-[2-(8-chloro-4-oxochromen-2-yl)-5-[3-(methoxymethoxy)-2,3-dioxopropyl]-4-nitrophenoxy]ethoxy]cyclobutane-1-carboxylic acid (PubChem CID 146460258) has the molecular formula C27H24ClNO12 and a molecular weight of 589.94 g/mol. Its IUPAC name is 3-[2-[2-(8-chloro-4-oxochromen-2-yl)-5-[3-(methoxymethoxy)-2,3-dioxopropyl]-4-nitrophenoxy]ethoxy]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[2-[2-(8-chloro-4-oxochromen-2-yl)-5-[3-(methoxymethoxy)-2,3-dioxopropyl]-4-nitrophenoxy]ethoxy]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 146460258 |
| Molecular Formula | C27H24ClNO12 |
| Molecular Weight | 589.94 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | 3-[2-[2-(8-chloro-4-oxochromen-2-yl)-5-[3-(methoxymethoxy)-2,3-dioxopropyl]-4-nitrophenoxy]ethoxy]cyclobutane-1-carboxylic acid |
| SMILES | COCOC(=O)C(=O)Cc1cc(OCCOC2CC(C(=O)O)C2)c(-c2cc(=O)c3cccc(Cl)c3o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H24ClNO12/c1-37-13-40-27(34)22(31)9-14-10-23(39-6-5-38-16-7-15(8-16)26(32)33)18(11-20(14)29(35)36)24-12-21(30)17-3-2-4-19(28)25(17)41-24/h2-4,10-12,15-16H,5-9,13H2,1H3,(H,32,33) |
| InChIKey | ULFPJZQPYBBXOK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 181.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.94 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|