C33H32O9S — CID 170025917
benzyl 2-[2-[2-[3-(1-methoxyethenyl)cyclobutyl]oxyethoxy]-4-methylsulfonylphenyl]-4-oxochromene-8-carboxylate (PubChem CID 170025917) has the molecular formula C33H32O9S and a molecular weight of 604.68 g/mol. Its IUPAC name is benzyl 2-[2-[2-[3-(1-methoxyethenyl)cyclobutyl]oxyethoxy]-4-methylsulfonylphenyl]-4-oxochromene-8-carboxylate.
| Compound Name | benzyl 2-[2-[2-[3-(1-methoxyethenyl)cyclobutyl]oxyethoxy]-4-methylsulfonylphenyl]-4-oxochromene-8-carboxylate |
|---|---|
| PubChem CID | 170025917 |
| Molecular Formula | C33H32O9S |
| Molecular Weight | 604.68 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | benzyl 2-[2-[2-[3-(1-methoxyethenyl)cyclobutyl]oxyethoxy]-4-methylsulfonylphenyl]-4-oxochromene-8-carboxylate |
| SMILES | C=C(OC)C1CC(OCCOc2cc(S(C)(=O)=O)ccc2-c2cc(=O)c3cccc(C(=O)OCc4ccccc4)c3o2)C1 |
| InChI | InChI=1S/C33H32O9S/c1-21(38-2)23-16-24(17-23)39-14-15-40-30-18-25(43(3,36)37)12-13-27(30)31-19-29(34)26-10-7-11-28(32(26)42-31)33(35)41-20-22-8-5-4-6-9-22/h4-13,18-19,23-24H,1,14-17,20H2,2-3H3 |
| InChIKey | ZMYGYTIAZZQGFV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.68 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|