About 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene
1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene (PubChem CID 11314953) has the molecular formula C11H11ClF3IO
and a molecular weight of 378.56 g/mol. Its IUPAC name is 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene.
Molecular Properties
| Compound Name | 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene |
| PubChem CID | 11314953 |
| Molecular Formula | C11H11ClF3IO |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene |
| SMILES | FC(F)(F)Cc1ccc(Cl)c(OCCCI)c1 |
| InChI | InChI=1S/C11H11ClF3IO/c12-9-3-2-8(7-11(13,14)15)6-10(9)17-5-1-4-16/h2-3,6H,1,4-5,7H2 |
| InChIKey | RNJVMFSUNSKPRE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene?
The IUPAC name of 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene (CID 11314953) is 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene.
What is the SMILES notation for 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene?
The canonical SMILES for 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene is FC(F)(F)Cc1ccc(Cl)c(OCCCI)c1.
What is the InChIKey of 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene?
The InChIKey is RNJVMFSUNSKPRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF3IO/c12-9-3-2-8(7-11(13,14)15)6-10(9)17-5-1-4-16/h2-3,6H,1,4-5,7H2.
What are the key properties of 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene?
1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene has a molecular weight of 378.56 g/mol, XLogP of 4.65, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(3-iodopropoxy)-4-(2,2,2-trifluoroethyl)benzene is sourced from PubChem (CID 11314953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).