C17H14F4O3 — CID 166342781
4-[2-[2-fluoro-4-(trifluoromethyl)phenyl]phenoxy]butanoic acid (PubChem CID 166342781) has the molecular formula C17H14F4O3 and a molecular weight of 342.29 g/mol. Its IUPAC name is 4-[2-[2-fluoro-4-(trifluoromethyl)phenyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-[2-fluoro-4-(trifluoromethyl)phenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 166342781 |
| Molecular Formula | C17H14F4O3 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-[2-[2-fluoro-4-(trifluoromethyl)phenyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccccc1-c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C17H14F4O3/c18-14-10-11(17(19,20)21)7-8-12(14)13-4-1-2-5-15(13)24-9-3-6-16(22)23/h1-2,4-5,7-8,10H,3,6,9H2,(H,22,23) |
| InChIKey | UPSQHDYYNOVMLK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|