C12H14FNO4 — CID 110466152
2-[4-(2-fluorophenoxy)butanoylamino]acetic acid (PubChem CID 110466152) has the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. Its IUPAC name is 2-[4-(2-fluorophenoxy)butanoylamino]acetic acid.
| Compound Name | 2-[4-(2-fluorophenoxy)butanoylamino]acetic acid |
|---|---|
| PubChem CID | 110466152 |
| Molecular Formula | C12H14FNO4 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-[4-(2-fluorophenoxy)butanoylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)CCCOc1ccccc1F |
| InChI | InChI=1S/C12H14FNO4/c13-9-4-1-2-5-10(9)18-7-3-6-11(15)14-8-12(16)17/h1-2,4-5H,3,6-8H2,(H,14,15)(H,16,17) |
| InChIKey | DNKQLFAKSSNLQQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|