C13H18FNO3 — CID 110466153
4-(2-fluorophenoxy)-N-(2-hydroxypropyl)butanamide (PubChem CID 110466153) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-N-(2-hydroxypropyl)butanamide.
| Compound Name | 4-(2-fluorophenoxy)-N-(2-hydroxypropyl)butanamide |
|---|---|
| PubChem CID | 110466153 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 4-(2-fluorophenoxy)-N-(2-hydroxypropyl)butanamide |
| SMILES | CC(O)CNC(=O)CCCOc1ccccc1F |
| InChI | InChI=1S/C13H18FNO3/c1-10(16)9-15-13(17)7-4-8-18-12-6-3-2-5-11(12)14/h2-3,5-6,10,16H,4,7-9H2,1H3,(H,15,17) |
| InChIKey | ULQUOAMYLASZKJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|