C19H22FNO3 — CID 111565790
N-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-(2-methylphenoxy)butanamide (PubChem CID 111565790) has the molecular formula C19H22FNO3 and a molecular weight of 331.39 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-(2-methylphenoxy)butanamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-(2-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 111565790 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-(2-methylphenoxy)butanamide |
| SMILES | Cc1ccccc1OCCCC(=O)NCC(O)c1ccccc1F |
| InChI | InChI=1S/C19H22FNO3/c1-14-7-2-5-10-18(14)24-12-6-11-19(23)21-13-17(22)15-8-3-4-9-16(15)20/h2-5,7-10,17,22H,6,11-13H2,1H3,(H,21,23) |
| InChIKey | IBSOYIJVKGHXQI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|