C13H14FNO2 — CID 60550880
4-(2-fluorophenoxy)-N-prop-2-ynylbutanamide (PubChem CID 60550880) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-N-prop-2-ynylbutanamide.
| Compound Name | 4-(2-fluorophenoxy)-N-prop-2-ynylbutanamide |
|---|---|
| PubChem CID | 60550880 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-(2-fluorophenoxy)-N-prop-2-ynylbutanamide |
| SMILES | C#CCNC(=O)CCCOc1ccccc1F |
| InChI | InChI=1S/C13H14FNO2/c1-2-9-15-13(16)8-5-10-17-12-7-4-3-6-11(12)14/h1,3-4,6-7H,5,8-10H2,(H,15,16) |
| InChIKey | BBUVZWFWUYXLIP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|