C18H17FN2O2 — CID 60549854
N-[(4-cyanophenyl)methyl]-4-(2-fluorophenoxy)butanamide (PubChem CID 60549854) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-4-(2-fluorophenoxy)butanamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-4-(2-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 60549854 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-4-(2-fluorophenoxy)butanamide |
| SMILES | N#Cc1ccc(CNC(=O)CCCOc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H17FN2O2/c19-16-4-1-2-5-17(16)23-11-3-6-18(22)21-13-15-9-7-14(12-20)8-10-15/h1-2,4-5,7-10H,3,6,11,13H2,(H,21,22) |
| InChIKey | LDOILDBELVVHEN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|