C17H15Cl6N3O4 — CID 150640710
2-[2-(3,4-dimethoxyphenyl)-1,2-dimethoxyethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 150640710) has the molecular formula C17H15Cl6N3O4 and a molecular weight of 538.04 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-1,2-dimethoxyethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-1,2-dimethoxyethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 150640710 |
| Molecular Formula | C17H15Cl6N3O4 |
| Molecular Weight | 538.04 g/mol |
| Exact Mass | 534.92 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-1,2-dimethoxyethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | COC(=C(OC)c1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H15Cl6N3O4/c1-27-9-6-5-8(7-10(9)28-2)11(29-3)12(30-4)13-24-14(16(18,19)20)26-15(25-13)17(21,22)23/h5-7H,1-4H3 |
| InChIKey | IZVOCUOCQJUVQW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.04 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|