C17H13Cl4N5 — CID 118250342
4-(4-chlorophenyl)-N-(2-pyridin-4-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 118250342) has the molecular formula C17H13Cl4N5 and a molecular weight of 429.14 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(2-pyridin-4-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-(2-pyridin-4-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118250342 |
| Molecular Formula | C17H13Cl4N5 |
| Molecular Weight | 429.14 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(2-pyridin-4-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | Clc1ccc(-c2nc(NCCc3ccncc3)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C17H13Cl4N5/c18-13-3-1-12(2-4-13)14-24-15(17(19,20)21)26-16(25-14)23-10-7-11-5-8-22-9-6-11/h1-6,8-9H,7,10H2,(H,23,24,25,26) |
| InChIKey | DEUWSNOIRCGEPD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.14 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|