C18H19Cl3F3N5 — CID 118250364
N-(3-pyrrolidin-1-ylpropyl)-4-(trichloromethyl)-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 118250364) has the molecular formula C18H19Cl3F3N5 and a molecular weight of 468.74 g/mol. Its IUPAC name is N-(3-pyrrolidin-1-ylpropyl)-4-(trichloromethyl)-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | N-(3-pyrrolidin-1-ylpropyl)-4-(trichloromethyl)-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118250364 |
| Molecular Formula | C18H19Cl3F3N5 |
| Molecular Weight | 468.74 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | N-(3-pyrrolidin-1-ylpropyl)-4-(trichloromethyl)-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)c1ccc(-c2nc(NCCCN3CCCC3)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C18H19Cl3F3N5/c19-17(20,21)15-26-14(12-4-6-13(7-5-12)18(22,23)24)27-16(28-15)25-8-3-11-29-9-1-2-10-29/h4-7H,1-3,8-11H2,(H,25,26,27,28) |
| InChIKey | VLHPSUQZHFYUPE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.74 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|